CAS 915416-45-4 appears in our catalog under these names: 3',4',5'-Trifluoro-[1,1'-biphenyl]-2-amine, 97%, 3',4',5'-Trifluoro-(1,1'-biphenyl)-2-amine, >95% (HPLC), 3',4',5'-Trifluoro-[1,1'-biphenyl]-2-amine, 95%. Offered by: Combi-blocks, TRC, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 10g, 25g.
2-(3,4,5-trifluorophenyl)aniline (CAS 915416-45-4) is a chemical compound with the molecular formula C12H8F3N and a molecular weight of 223.19 g/mol. IUPAC name: 2-(3,4,5-trifluorophenyl)aniline. InChIKey: FTIKVBVUYPQUBF-UHFFFAOYSA-N.
| Molecular formula | C12H8F3N |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 2-(3,4,5-trifluorophenyl)aniline |
| InChIKey | FTIKVBVUYPQUBF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C(=C2)F)F)F)N |
Computed by PubChem (NCBI)