CAS 121054-30-6 appears in our catalog under these names: Aztreonam Impurity 20, (3S,2S)-2,3-Diaminobutyric acid 2HCl, (3S,2S)-2,3-Diaminobutyric Acid Dihydrochloride. Offered by: Chemat Brand, Creative Peptides, TRC. Available pack sizes: on request, 250mg.
(2S,3S)-2,3-diaminobutanoic acid;dihydrochloride (CAS 121054-30-6) is a chemical compound with the molecular formula C4H12Cl2N2O2 and a molecular weight of 191.05 g/mol. IUPAC name: (2S,3S)-2,3-diaminobutanoic acid;dihydrochloride. InChIKey: DOZGWJGZHSTDJL-BQIXHFABSA-N.
| Molecular formula | C4H12Cl2N2O2 |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | (2S,3S)-2,3-diaminobutanoic acid;dihydrochloride |
| InChIKey | DOZGWJGZHSTDJL-BQIXHFABSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)N)N.Cl.Cl |
Computed by PubChem (NCBI)