CAS 648922-13-8 is the registry number for (3S,2R)-2,3-Diaminobutyric acid 2HCl. Offered by: Creative Peptides. Available pack sizes: on request.
(2R,3S)-2,3-diaminobutanoic acid;dihydrochloride (CAS 648922-13-8) is a chemical compound with the molecular formula C4H12Cl2N2O2 and a molecular weight of 191.05 g/mol. IUPAC name: (2R,3S)-2,3-diaminobutanoic acid;dihydrochloride. InChIKey: DOZGWJGZHSTDJL-JSTPYPERSA-N.
| Molecular formula | C4H12Cl2N2O2 |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | (2R,3S)-2,3-diaminobutanoic acid;dihydrochloride |
| InChIKey | DOZGWJGZHSTDJL-JSTPYPERSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)N)N.Cl.Cl |
Computed by PubChem (NCBI)