CAS 127531-11-7 appears in our catalog under these names: H–D–Dab–OH?2HCl, H-D-Dab-OH*2HCl, H-D-Dab-OH·2HCl 98%, H-D-Dab-OH·2HCl 99%, D-Dab.2HCl. Offered by: GLPBio, Iris Biotech, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
(2R)-2,4-diaminobutanoic acid;dihydrochloride (CAS 127531-11-7) is a chemical compound with the molecular formula C4H12Cl2N2O2 and a molecular weight of 191.05 g/mol. IUPAC name: (2R)-2,4-diaminobutanoic acid;dihydrochloride. InChIKey: CKAAWCHIBBNLOJ-HWYNEVGZSA-N.
| Molecular formula | C4H12Cl2N2O2 |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | (2R)-2,4-diaminobutanoic acid;dihydrochloride |
| InChIKey | CKAAWCHIBBNLOJ-HWYNEVGZSA-N |
| SMILES | C(CN)[C@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)