CAS 215652-51-0 appears in our catalog under these names: (3R,2S)-2,3-Diaminobutyric acid 2HCl, (2S,3R)-2,3-Diaminobutanoic acid dihydrochloride, 95+%. Offered by: Creative Peptides, AmBeed. Available pack sizes: on request, 1g, 5g.
(2S,3R)-2,3-diaminobutanoic acid;dihydrochloride (CAS 215652-51-0) is a chemical compound with the molecular formula C4H12Cl2N2O2 and a molecular weight of 191.05 g/mol. IUPAC name: (2S,3R)-2,3-diaminobutanoic acid;dihydrochloride. InChIKey: DOZGWJGZHSTDJL-OTUWWBTESA-N.
| Molecular formula | C4H12Cl2N2O2 |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | (2S,3R)-2,3-diaminobutanoic acid;dihydrochloride |
| InChIKey | DOZGWJGZHSTDJL-OTUWWBTESA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)N.Cl.Cl |
Computed by PubChem (NCBI)