CAS 1210709-69-5 is the registry number for 5-Bromo-N-methyl-N-(thiazol-2-yl)furan-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-methyl-N-(1,3-thiazol-2-yl)furan-2-carboxamide (CAS 1210709-69-5) is a chemical compound with the molecular formula C9H7BrN2O2S and a molecular weight of 287.14 g/mol. IUPAC name: 5-bromo-N-methyl-N-(1,3-thiazol-2-yl)furan-2-carboxamide. InChIKey: NPKSJXAAZKQWKE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2S |
|---|---|
| Molecular weight | 287.14 g/mol |
| IUPAC name | 5-bromo-N-methyl-N-(1,3-thiazol-2-yl)furan-2-carboxamide |
| InChIKey | NPKSJXAAZKQWKE-UHFFFAOYSA-N |
| SMILES | CN(C1=NC=CS1)C(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)