Products 1871794-98-7
CAS 1871794-98-7 is the registry number for 4-(3-Bromopyridin-2-yl)thiomorpholine-3,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-bromo-2-pyridinyl)thiomorpholine-3,5-dione (CAS 1871794-98-7) is a chemical compound with the molecular formula C9H7BrN2O2S and a molecular weight of 287.14 g/mol. IUPAC name: 4-(3-bromo-2-pyridinyl)thiomorpholine-3,5-dione. InChIKey: RPQBMRQFKCCLDY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2S |
|---|---|
| Molecular weight | 287.14 g/mol |
| IUPAC name | 4-(3-bromo-2-pyridinyl)thiomorpholine-3,5-dione |
| InChIKey | RPQBMRQFKCCLDY-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)CS1)C2=C(C=CC=N2)Br |
Computed by PubChem (NCBI)