CAS 304510-03-0 appears in our catalog under these names: 5-Bromo-n-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide, 95%, 5-Bromo-N-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-bromo-N-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide (CAS 304510-03-0) is a chemical compound with the molecular formula C9H7BrN2O2S and a molecular weight of 287.14 g/mol. IUPAC name: 5-bromo-N-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide. InChIKey: PEZPKRCSYQLBMP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2S |
|---|---|
| Molecular weight | 287.14 g/mol |
| IUPAC name | 5-bromo-N-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide |
| InChIKey | PEZPKRCSYQLBMP-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)NC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)