CAS 1572518-01-4 is the registry number for Methyl 3-amino-4-bromothieno[2,3-c]pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-amino-4-bromothieno[2,3-c]pyridine-2-carboxylate (CAS 1572518-01-4) is a chemical compound with the molecular formula C9H7BrN2O2S and a molecular weight of 287.14 g/mol. IUPAC name: methyl 3-amino-4-bromothieno[2,3-c]pyridine-2-carboxylate. InChIKey: OTKZSKNQYWGGHL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2S |
|---|---|
| Molecular weight | 287.14 g/mol |
| IUPAC name | methyl 3-amino-4-bromothieno[2,3-c]pyridine-2-carboxylate |
| InChIKey | OTKZSKNQYWGGHL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(C=NC=C2S1)Br)N |
Computed by PubChem (NCBI)