CAS 1210822-80-2 appears in our catalog under these names: 3-(1-Phenyl-3-(4-phenylphenyl)-1H-pyrazol-4-yl)propanoic acid, 95%, 3-(1-Phenyl-3-(4-phenylphenyl)-1H-pyrazol-4-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-[1-phenyl-3-(4-phenylphenyl)pyrazol-4-yl]propanoic acid (CAS 1210822-80-2) is a chemical compound with the molecular formula C24H20N2O2 and a molecular weight of 368.4 g/mol. IUPAC name: 3-[1-phenyl-3-(4-phenylphenyl)pyrazol-4-yl]propanoic acid. InChIKey: CKUQHJJNVUDLOH-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 3-[1-phenyl-3-(4-phenylphenyl)pyrazol-4-yl]propanoic acid |
| InChIKey | CKUQHJJNVUDLOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NN(C=C3CCC(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)