CAS 2072108-77-9 is the registry number for N1,N2-Bis(2-methyl-1-naphthalenyl)ethanediamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N,N'-bis(2-methylnaphthalen-1-yl)oxamide (CAS 2072108-77-9) is a chemical compound with the molecular formula C24H20N2O2 and a molecular weight of 368.4 g/mol. IUPAC name: N,N'-bis(2-methylnaphthalen-1-yl)oxamide. InChIKey: VHBGLZFOYNGREC-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | N,N'-bis(2-methylnaphthalen-1-yl)oxamide |
| InChIKey | VHBGLZFOYNGREC-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C=C1)NC(=O)C(=O)NC3=C(C=CC4=CC=CC=C43)C |
Computed by PubChem (NCBI)