CAS 65801-73-2 appears in our catalog under these names: 4,4'-((1,1'-Biphenyl)-2,2'-diylbis(oxy))dianiline, 97%, 4,4'-[[1,1'-Biphenyl]-2,2'-diylbis(oxy)]dianiline, >98.0%(HPLC)(T), 4,4'-([1,1'-Biphenyl]-2,2'-diylbis(oxy))dianiline, 98.0%, 98.0%, 2,2'-BIS(4-AMINOPHENOXY)BIPHENYL, 97%. Offered by: AmBeed, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-[2-[2-(4-aminophenoxy)phenyl]phenoxy]aniline (CAS 65801-73-2) is a chemical compound with the molecular formula C24H20N2O2 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[2-[2-(4-aminophenoxy)phenyl]phenoxy]aniline. InChIKey: GAXOPMJVJBPXRN-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[2-[2-(4-aminophenoxy)phenyl]phenoxy]aniline |
| InChIKey | GAXOPMJVJBPXRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2OC3=CC=C(C=C3)N)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)