Products 1211392-30-1
CAS 1211392-30-1 appears in our catalog under these names: 2-Amino-2-benzyl-3-phenylpropanoic acid hydrobromide, 2-Amino-2-benzyl-3-phenylpropanoic acid hydrobromide, 95%, 95%, 2-Amino-2-benzyl-3-phenylpropanoic acid hydrobromide, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-amino-2-benzyl-3-phenylpropanoic acid;hydrobromide (CAS 1211392-30-1) is a chemical compound with the molecular formula C16H18BrNO2 and a molecular weight of 336.22 g/mol. IUPAC name: 2-amino-2-benzyl-3-phenylpropanoic acid;hydrobromide. InChIKey: PVNKCQATBJOVTJ-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO2 |
|---|---|
| Molecular weight | 336.22 g/mol |
| IUPAC name | 2-amino-2-benzyl-3-phenylpropanoic acid;hydrobromide |
| InChIKey | PVNKCQATBJOVTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CC2=CC=CC=C2)(C(=O)O)N.Br |
Computed by PubChem (NCBI)