CAS 1211430-27-1 is the registry number for 2-(Chloromethyl)-6,7-dihydro-1h-[1,4]dioxino[2,3-f]benzimidazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(chloromethyl)-6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazole;hydrochloride (CAS 1211430-27-1) is a chemical compound with the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.10 g/mol. IUPAC name: 2-(chloromethyl)-6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazole;hydrochloride. InChIKey: RNEXGBURHGPCPN-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 2-(chloromethyl)-6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazole;hydrochloride |
| InChIKey | RNEXGBURHGPCPN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C3C(=C2)N=C(N3)CCl.Cl |
Computed by PubChem (NCBI)