CAS 28317-49-9 appears in our catalog under these names: Ethyl 2-chloro-2-(2-(2-chlorophenyl)hydrazono)acetate, 97%, Ethyl 2-chloro-2-[2-(2-chlorophenyl)hydrazono]-acetate. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
Ethyl (2Z)-2-chloro-2-[(2-chlorophenyl)hydrazinylidene]acetate (CAS 28317-49-9) is a chemical compound with the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.10 g/mol. IUPAC name: ethyl (2Z)-2-chloro-2-[(2-chlorophenyl)hydrazinylidene]acetate. InChIKey: LTPRVINQSYJPIR-ZROIWOOFSA-N.
| Molecular formula | C10H10Cl2N2O2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | ethyl (2Z)-2-chloro-2-[(2-chlorophenyl)hydrazinylidene]acetate |
| InChIKey | LTPRVINQSYJPIR-ZROIWOOFSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC=CC=C1Cl)/Cl |
Computed by PubChem (NCBI)