CAS 2653-08-9 appears in our catalog under these names: 2-Chloro-n-[4-(2-chloro-acetylamino)-phenyl]-acetamide, 95%, N,N'-(1,4-Phenylene)bis(2-chloroacetamide) 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-chloro-N-[4-[(2-chloroacetyl)amino]phenyl]acetamide (CAS 2653-08-9) is a chemical compound with the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.10 g/mol. IUPAC name: 2-chloro-N-[4-[(2-chloroacetyl)amino]phenyl]acetamide. InChIKey: RKJYUCXSQOPWBA-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 2-chloro-N-[4-[(2-chloroacetyl)amino]phenyl]acetamide |
| InChIKey | RKJYUCXSQOPWBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CCl)NC(=O)CCl |
Computed by PubChem (NCBI)