CAS 337924-73-9 is the registry number for Methyl 2-[1-(3,4-dichlorophenyl)ethylidene]-1-hydrazinecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]carbamate (CAS 337924-73-9) is a chemical compound with the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.10 g/mol. IUPAC name: methyl N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]carbamate. InChIKey: ZQMXGUXUENZYOA-AWNIVKPZSA-N.
| Molecular formula | C10H10Cl2N2O2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | methyl N-[(E)-1-(3,4-dichlorophenyl)ethylideneamino]carbamate |
| InChIKey | ZQMXGUXUENZYOA-AWNIVKPZSA-N |
| SMILES | C/C(=N\NC(=O)OC)/C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)