CAS 1211522-28-9 is the registry number for 2-Methyl-5-(trifluoromethyl)oxazole-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carbaldehyde (CAS 1211522-28-9) is a chemical compound with the molecular formula C6H4F3NO2 and a molecular weight of 179.10 g/mol. IUPAC name: 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carbaldehyde. InChIKey: DBADGIZSFDFPKL-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2 |
|---|---|
| Molecular weight | 179.10 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carbaldehyde |
| InChIKey | DBADGIZSFDFPKL-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)