CAS 771-52-8 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)-2,5-dihydro-1H-pyrrole-2,5-dione, 95%, 1-(2,2,2-Trifluoroethyl)-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(2,2,2-trifluoroethyl)pyrrole-2,5-dione (CAS 771-52-8) is a chemical compound with the molecular formula C6H4F3NO2 and a molecular weight of 179.10 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrrole-2,5-dione. InChIKey: IWRBOJITNPGNMD-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2 |
|---|---|
| Molecular weight | 179.10 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrrole-2,5-dione |
| InChIKey | IWRBOJITNPGNMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CC(F)(F)F |
Computed by PubChem (NCBI)