CAS 123324-24-3 appears in our catalog under these names: 4-(Trifluoromethyl)-1H-pyrrole-3-carboxylic acid, 4-(Trifluoromethyl)-1H-pyrrole-3-carboxylic acid, 98%, 4-(Trifluoromethyl)-1H-pyrrole-3-carboxylic acid 95%, 4-(Trifluoromethyl)-1H-pyrrole-3-carboxylic acid, 95%, 95%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 1g, 5g, 25mg, 100mg, 250mg.
4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid (CAS 123324-24-3) is a chemical compound with the molecular formula C6H4F3NO2 and a molecular weight of 179.10 g/mol. IUPAC name: 4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid. InChIKey: CFNJWBNBIDWUEN-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2 |
|---|---|
| Molecular weight | 179.10 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid |
| InChIKey | CFNJWBNBIDWUEN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)