Products 1211536-96-7

CAS 1211536-96-7 is the registry number for 6-Fluoro-3-methylpicolinic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

6-fluoro-3-methylpyridine-2-carboxylic acid (CAS 1211536-96-7) is a chemical compound with the molecular formula C7H6FNO2 and a molecular weight of 155.13 g/mol. IUPAC name: 6-fluoro-3-methylpyridine-2-carboxylic acid. InChIKey: WRBDGOOGUQSVNF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6FNO2
Molecular weight155.13 g/mol
IUPAC name6-fluoro-3-methylpyridine-2-carboxylic acid
InChIKeyWRBDGOOGUQSVNF-UHFFFAOYSA-N
SMILESCC1=C(N=C(C=C1)F)C(=O)O

Computed by PubChem (NCBI)