Products 1211537-23-3

CAS 1211537-23-3 appears in our catalog under these names: 5-Bromo-4-methylpyridine-2-carbonyl chloride, 95%, 5-Bromo-4-methylpicolinoyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-bromo-4-methylpyridine-2-carbonyl chloride (CAS 1211537-23-3) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: 5-bromo-4-methylpyridine-2-carbonyl chloride. InChIKey: REMUVCHWMGYWFW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrClNO
Molecular weight234.48 g/mol
IUPAC name5-bromo-4-methylpyridine-2-carbonyl chloride
InChIKeyREMUVCHWMGYWFW-UHFFFAOYSA-N
SMILESCC1=CC(=NC=C1Br)C(=O)Cl

Computed by PubChem (NCBI)