Products 1211541-20-6

CAS 1211541-20-6 is the registry number for 5-Chloro-2-ethyl-pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-chloro-2-ethylpyridine-3-carboxylic acid (CAS 1211541-20-6) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 5-chloro-2-ethylpyridine-3-carboxylic acid. InChIKey: PTISKBHCXHEQMN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO2
Molecular weight185.61 g/mol
IUPAC name5-chloro-2-ethylpyridine-3-carboxylic acid
InChIKeyPTISKBHCXHEQMN-UHFFFAOYSA-N
SMILESCCC1=C(C=C(C=N1)Cl)C(=O)O

Computed by PubChem (NCBI)