Products 1211589-63-7
CAS 1211589-63-7 is the registry number for 5-(tert-Butyl)nicotinic acid, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-tert-butylpyridine-3-carboxylic acid (CAS 1211589-63-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 5-tert-butylpyridine-3-carboxylic acid. InChIKey: LFFKLILKZSVRJV-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 5-tert-butylpyridine-3-carboxylic acid |
| InChIKey | LFFKLILKZSVRJV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)