Products 121191-53-5
CAS 121191-53-5 appears in our catalog under these names: Terephthalic acid–13C2, Terephthalic acid-13C2, 99.60%, Terephthalic acid-13C2, 98%, Terephthalic-carboxy-13C2 acid,. Offered by: GLPBio, MedChemExpress, Chemat, Sigma-Aldrich. Available pack sizes: 5mg, 1mg, 10mg, 10 mg, 1 mg, 25 mg, 5 mg, 250MG.
Terephthalic acid (CAS 121191-53-5) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 168.12 g/mol. IUPAC name: terephthalic acid. InChIKey: KKEYFWRCBNTPAC-BFGUONQLSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | terephthalic acid |
| InChIKey | KKEYFWRCBNTPAC-BFGUONQLSA-N |
| SMILES | C1=CC(=CC=C1[13C](=O)O)[13C](=O)O |
Computed by PubChem (NCBI)