CAS 121202-20-8 is the registry number for [2-(3-Chlorophenyl)-1,3-thiazol-4-yl]methanol, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
[2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanol (CAS 121202-20-8) is a chemical compound with the molecular formula C10H8ClNOS and a molecular weight of 225.70 g/mol. IUPAC name: [2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanol. InChIKey: YTNKAEKSQBOUNF-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNOS |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | [2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanol |
| InChIKey | YTNKAEKSQBOUNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=CS2)CO |
Computed by PubChem (NCBI)