CAS 2104-01-0 is the registry number for 2-Chloro-4-(4-methoxyphenyl)thiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-chloro-4-(4-methoxyphenyl)-1,3-thiazole (CAS 2104-01-0) is a chemical compound with the molecular formula C10H8ClNOS and a molecular weight of 225.70 g/mol. IUPAC name: 2-chloro-4-(4-methoxyphenyl)-1,3-thiazole. InChIKey: STQGABPTLYUHSE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNOS |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | 2-chloro-4-(4-methoxyphenyl)-1,3-thiazole |
| InChIKey | STQGABPTLYUHSE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CSC(=N2)Cl |
Computed by PubChem (NCBI)