CAS 339018-23-4 appears in our catalog under these names: (2-Chloro-1,3-thiazol-5-yl)methyl phenyl ether, 95%, (2-CHLORO-1,3-THIAZOL-5-YL)METHYL PHENYL ETHER, 95+%, 95+%, 2-Chloro-5-(phenoxymethyl)thiazole, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
2-chloro-5-(phenoxymethyl)-1,3-thiazole (CAS 339018-23-4) is a chemical compound with the molecular formula C10H8ClNOS and a molecular weight of 225.70 g/mol. IUPAC name: 2-chloro-5-(phenoxymethyl)-1,3-thiazole. InChIKey: DKLDULIVLVOTMM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNOS |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | 2-chloro-5-(phenoxymethyl)-1,3-thiazole |
| InChIKey | DKLDULIVLVOTMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CN=C(S2)Cl |
Computed by PubChem (NCBI)