Products 287198-05-4
CAS 287198-05-4 is the registry number for (4-(4-Chlorophenyl)thiazol-2-yl)methanol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanol (CAS 287198-05-4) is a chemical compound with the molecular formula C10H8ClNOS and a molecular weight of 225.70 g/mol. IUPAC name: [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanol. InChIKey: UICGABWUJKMBEN-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNOS |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanol |
| InChIKey | UICGABWUJKMBEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)CO)Cl |
Computed by PubChem (NCBI)