CAS 1212064-22-6 appears in our catalog under these names: Rel-tert-butyl ((1R,2R)-2-aminocyclopropyl)carbamate hydrochloride, 98%, tert-Butyl N-[trans-2-aminocyclopropyl]carbamate hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
Tert-butyl N-[(1S,2S)-2-aminocyclopropyl]carbamate;hydrochloride (CAS 1212064-22-6) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: tert-butyl N-[(1S,2S)-2-aminocyclopropyl]carbamate;hydrochloride. InChIKey: YSEZNMFHOVBUCK-GEMLJDPKSA-N.
| Molecular formula | C8H17ClN2O2 |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S)-2-aminocyclopropyl]carbamate;hydrochloride |
| InChIKey | YSEZNMFHOVBUCK-GEMLJDPKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H]1N.Cl |
Computed by PubChem (NCBI)