CAS 1949805-93-9 is the registry number for tert-Butyl ((1R,2R)-2-aminocyclopropyl)carbamate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl N-[(1R,2R)-2-aminocyclopropyl]carbamate;hydrochloride (CAS 1949805-93-9) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-aminocyclopropyl]carbamate;hydrochloride. InChIKey: YSEZNMFHOVBUCK-KGZKBUQUSA-N.
| Molecular formula | C8H17ClN2O2 |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-aminocyclopropyl]carbamate;hydrochloride |
| InChIKey | YSEZNMFHOVBUCK-KGZKBUQUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]1N.Cl |
Computed by PubChem (NCBI)