CAS 1212081-91-8 is the registry number for (1R)-1-(5,6,7,8-Tetrahydronaphthalen-2-yl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanol (CAS 1212081-91-8) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: (1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanol. InChIKey: ZZAIKACKOJSLBZ-SECBINFHSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | (1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanol |
| InChIKey | ZZAIKACKOJSLBZ-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC2=C(CCCC2)C=C1)O |
Computed by PubChem (NCBI)