CAS 1212283-95-8 is the registry number for (1S)-1-(5,6,7,8-Tetrahydronaphthalen-2-yl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanol (CAS 1212283-95-8) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: (1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanol. InChIKey: ZZAIKACKOJSLBZ-VIFPVBQESA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | (1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanol |
| InChIKey | ZZAIKACKOJSLBZ-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC2=C(CCCC2)C=C1)O |
Computed by PubChem (NCBI)