Products 1212145-02-2
CAS 1212145-02-2 is the registry number for Diexo-3-amino-7-oxa-bicyclo[2.2.1]heptane-2-carboxylic acid ethyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride (CAS 1212145-02-2) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: ethyl (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride. InChIKey: AOQQPBDWIFYSRA-ICDZOTBQSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | ethyl (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride |
| InChIKey | AOQQPBDWIFYSRA-ICDZOTBQSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CC[C@@H]([C@@H]1N)O2.Cl |
Computed by PubChem (NCBI)