Products 24318-88-5

CAS 24318-88-5 is the registry number for Methyl 1-ethyl-4-oxo-3-piperidinecarboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Methyl 1-ethyl-4-oxopiperidine-3-carboxylate;hydrochloride (CAS 24318-88-5) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: methyl 1-ethyl-4-oxopiperidine-3-carboxylate;hydrochloride. InChIKey: LLPWEDHIONCBTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO3
Molecular weight221.68 g/mol
IUPAC namemethyl 1-ethyl-4-oxopiperidine-3-carboxylate;hydrochloride
InChIKeyLLPWEDHIONCBTQ-UHFFFAOYSA-N
SMILESCCN1CCC(=O)C(C1)C(=O)OC.Cl

Computed by PubChem (NCBI)