Products 1402243-32-6
CAS 1402243-32-6 is the registry number for Ethyl (S)-3-oxo-3-(pyrrolidin-2-yl)propanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-oxo-3-[(2S)-pyrrolidin-2-yl]propanoate;hydrochloride (CAS 1402243-32-6) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: ethyl 3-oxo-3-[(2S)-pyrrolidin-2-yl]propanoate;hydrochloride. InChIKey: FWOKYJWVESSKHD-FJXQXJEOSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | ethyl 3-oxo-3-[(2S)-pyrrolidin-2-yl]propanoate;hydrochloride |
| InChIKey | FWOKYJWVESSKHD-FJXQXJEOSA-N |
| SMILES | CCOC(=O)CC(=O)[C@@H]1CCCN1.Cl |
Computed by PubChem (NCBI)