CAS 2680541-86-8 is the registry number for Methyl 1-(methoxymethyl)-2-azabicyclo[2.1.1]hexane-4-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(methoxymethyl)-2-azabicyclo[2.1.1]hexane-4-carboxylate;hydrochloride (CAS 2680541-86-8) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: methyl 1-(methoxymethyl)-2-azabicyclo[2.1.1]hexane-4-carboxylate;hydrochloride. InChIKey: ZNAYSBOSKYLSJY-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | methyl 1-(methoxymethyl)-2-azabicyclo[2.1.1]hexane-4-carboxylate;hydrochloride |
| InChIKey | ZNAYSBOSKYLSJY-UHFFFAOYSA-N |
| SMILES | COCC12CC(C1)(CN2)C(=O)OC.Cl |
Computed by PubChem (NCBI)