Products 1823547-10-9

CAS 1823547-10-9 is the registry number for Ethyl oxo(piperidin-2-yl)acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-oxo-2-piperidin-2-ylacetate;hydrochloride (CAS 1823547-10-9) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: ethyl 2-oxo-2-piperidin-2-ylacetate;hydrochloride. InChIKey: QTPVNSQNPLWQMT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO3
Molecular weight221.68 g/mol
IUPAC nameethyl 2-oxo-2-piperidin-2-ylacetate;hydrochloride
InChIKeyQTPVNSQNPLWQMT-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)C1CCCCN1.Cl

Computed by PubChem (NCBI)