CAS 1212160-00-3 is the registry number for (R)-2-(3,4,5-Trimethoxyphenyl)butanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-(3,4,5-trimethoxyphenyl)butanoic acid (CAS 1212160-00-3) is a chemical compound with the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. IUPAC name: (2R)-2-(3,4,5-trimethoxyphenyl)butanoic acid. InChIKey: WBULUDGUWZFLMO-SECBINFHSA-N.
| Molecular formula | C13H18O5 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (2R)-2-(3,4,5-trimethoxyphenyl)butanoic acid |
| InChIKey | WBULUDGUWZFLMO-SECBINFHSA-N |
| SMILES | CC[C@H](C1=CC(=C(C(=C1)OC)OC)OC)C(=O)O |
Computed by PubChem (NCBI)