Products 121218-70-0
CAS 121218-70-0 is the registry number for 1,5-Dimethyl 3-(nitromethyl)pentanedioate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Dimethyl 3-(nitromethyl)pentanedioate (CAS 121218-70-0) is a chemical compound with the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. IUPAC name: dimethyl 3-(nitromethyl)pentanedioate. InChIKey: XFTAIQNHWDSIRS-UHFFFAOYSA-N.
| Molecular formula | C8H13NO6 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | dimethyl 3-(nitromethyl)pentanedioate |
| InChIKey | XFTAIQNHWDSIRS-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(CC(=O)OC)C[N+](=O)[O-] |
Computed by PubChem (NCBI)