CAS 28876-37-1 appears in our catalog under these names: 2-Acetamido-2-deoxy-D-mannono-1,4-lactone, >95% (HPLC), D-Mannonic acid,2-(acetylamino)-2-deoxy,γ-lactone. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 25 mg, 50 mg, 10 mg.
N-[(3S,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-2-oxooxolan-3-yl]acetamide (CAS 28876-37-1) is a chemical compound with the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. IUPAC name: N-[(3S,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-2-oxooxolan-3-yl]acetamide. InChIKey: JYOPKUOOYNIILV-XZBKPIIZSA-N.
| Molecular formula | C8H13NO6 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | N-[(3S,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-2-oxooxolan-3-yl]acetamide |
| InChIKey | JYOPKUOOYNIILV-XZBKPIIZSA-N |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](OC1=O)[C@@H](CO)O)O |
Computed by PubChem (NCBI)