Products 5437-39-8

CAS 5437-39-8 is the registry number for 4-Methyl-4-nitroheptanedioic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

4-methyl-4-nitroheptanedioic acid (CAS 5437-39-8) is a chemical compound with the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. IUPAC name: 4-methyl-4-nitroheptanedioic acid. InChIKey: QSVSXKWXZSDWIU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13NO6
Molecular weight219.19 g/mol
IUPAC name4-methyl-4-nitroheptanedioic acid
InChIKeyQSVSXKWXZSDWIU-UHFFFAOYSA-N
SMILESCC(CCC(=O)O)(CCC(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)