CAS 1706458-74-3 is the registry number for 2,5-Dioxa-8-azaspiro(3.5)nonane oxalate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,5-dioxa-8-azaspiro[3.5]nonane;oxalic acid (CAS 1706458-74-3) is a chemical compound with the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. IUPAC name: 2,5-dioxa-8-azaspiro[3.5]nonane;oxalic acid. InChIKey: WVQJYPJGFDIXNI-UHFFFAOYSA-N.
| Molecular formula | C8H13NO6 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 2,5-dioxa-8-azaspiro[3.5]nonane;oxalic acid |
| InChIKey | WVQJYPJGFDIXNI-UHFFFAOYSA-N |
| SMILES | C1COC2(CN1)COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)