CAS 121219-09-8 appears in our catalog under these names: 4-Bromo-2,5-difluoro-1,1'-biphenyl, 95%, 4-Bromo-2,5-difluoro-1,1'-biphenyl, 98%, 4-Bromo-2,5-difluoro-1,1'-biphenyl, 95%, 95%, 4-Bromo-2,5-difluoro-1,1'-biphenyl, >=95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1-bromo-2,5-difluoro-4-phenylbenzene (CAS 121219-09-8) is a chemical compound with the molecular formula C12H7BrF2 and a molecular weight of 269.08 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-phenylbenzene. InChIKey: HGNFGQUXRKLBSQ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrF2 |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-phenylbenzene |
| InChIKey | HGNFGQUXRKLBSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)