CAS 531529-35-8 is the registry number for 4-Bromo-2,4'-difluoro-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-bromo-2-fluoro-1-(4-fluorophenyl)benzene (CAS 531529-35-8) is a chemical compound with the molecular formula C12H7BrF2 and a molecular weight of 269.08 g/mol. IUPAC name: 4-bromo-2-fluoro-1-(4-fluorophenyl)benzene. InChIKey: MEZKHGAKWYDQIC-UHFFFAOYSA-N.
| Molecular formula | C12H7BrF2 |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1-(4-fluorophenyl)benzene |
| InChIKey | MEZKHGAKWYDQIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)Br)F)F |
Computed by PubChem (NCBI)