CAS 3002437-55-7 is the registry number for 3-bromo-2,4-difluoro-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1,3-difluoro-4-phenylbenzene (CAS 3002437-55-7) is a chemical compound with the molecular formula C12H7BrF2 and a molecular weight of 269.08 g/mol. IUPAC name: 2-bromo-1,3-difluoro-4-phenylbenzene. InChIKey: LAKUOTIJQVRNGA-UHFFFAOYSA-N.
| Molecular formula | C12H7BrF2 |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 2-bromo-1,3-difluoro-4-phenylbenzene |
| InChIKey | LAKUOTIJQVRNGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C=C2)F)Br)F |
Computed by PubChem (NCBI)