CAS 204776-95-4 appears in our catalog under these names: 4'-Bromo-3,5-difluoro-1,1'-biphenyl, 95%, 95%, 4-Bromo-3',5'-difluorobiphenyl, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromophenyl)-3,5-difluorobenzene (CAS 204776-95-4) is a chemical compound with the molecular formula C12H7BrF2 and a molecular weight of 269.08 g/mol. IUPAC name: 1-(4-bromophenyl)-3,5-difluorobenzene. InChIKey: GUYWOVXWSWXETF-UHFFFAOYSA-N.
| Molecular formula | C12H7BrF2 |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3,5-difluorobenzene |
| InChIKey | GUYWOVXWSWXETF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)F)F)Br |
Computed by PubChem (NCBI)