CAS 1212305-88-8 appears in our catalog under these names: 6-(Fmoc-NH)-cis-cyclohex-3-ene-COOH, Fmoc-cis-1,2-aminocyclohex-4-ene carboxylic acid 95%. Offered by: Iris Biotech, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
(1R,6S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid (CAS 1212305-88-8) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: (1R,6S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid. InChIKey: WYVXOQUBSSBXKD-QUCCMNQESA-N.
| Molecular formula | C22H21NO4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | (1R,6S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylic acid |
| InChIKey | WYVXOQUBSSBXKD-QUCCMNQESA-N |
| SMILES | C1C=CC[C@@H]([C@@H]1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)