Products 1212335-61-9
CAS 1212335-61-9 appears in our catalog under these names: (2S)-2-(4-Acetylbenzenesulfonamido)propanoic acid, 95%, (2S)-2-(4-Acetylbenzenesulfonamido)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(2S)-2-[(4-acetylphenyl)sulfonylamino]propanoic acid (CAS 1212335-61-9) is a chemical compound with the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. IUPAC name: (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoic acid. InChIKey: QHENZMYFROYGBF-ZETCQYMHSA-N.
| Molecular formula | C11H13NO5S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoic acid |
| InChIKey | QHENZMYFROYGBF-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)