CAS 1212837-29-0 is the registry number for (S)-2-(3-Bromo-5-(trifluoromethyl)phenyl)-2-(methylamino)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[3-bromo-5-(trifluoromethyl)phenyl]-2-(methylamino)ethanol (CAS 1212837-29-0) is a chemical compound with the molecular formula C10H11BrF3NO and a molecular weight of 298.10 g/mol. IUPAC name: (2S)-2-[3-bromo-5-(trifluoromethyl)phenyl]-2-(methylamino)ethanol. InChIKey: NKEMOJXIZNRMMV-SECBINFHSA-N.
| Molecular formula | C10H11BrF3NO |
|---|---|
| Molecular weight | 298.10 g/mol |
| IUPAC name | (2S)-2-[3-bromo-5-(trifluoromethyl)phenyl]-2-(methylamino)ethanol |
| InChIKey | NKEMOJXIZNRMMV-SECBINFHSA-N |
| SMILES | CN[C@H](CO)C1=CC(=CC(=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)